C20H14ClN5O3S2 — CID 25264472
N-[5-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]-4-nitrobenzamide (PubChem CID 25264472) has the molecular formula C20H14ClN5O3S2 and a molecular weight of 471.95 g/mol. Its IUPAC name is N-[5-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]-4-nitrobenzamide.
| Compound Name | N-[5-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 25264472 |
| Molecular Formula | C20H14ClN5O3S2 |
| Molecular Weight | 471.95 g/mol |
| Exact Mass | 471.02 |
| IUPAC Name | N-[5-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]-4-nitrobenzamide |
| SMILES | Cc1nc(NC(=O)c2ccc([N+](=O)[O-])cc2)sc1-c1csc(Nc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C20H14ClN5O3S2/c1-11-17(16-10-30-19(24-16)23-14-6-4-13(21)5-7-14)31-20(22-11)25-18(27)12-2-8-15(9-3-12)26(28)29/h2-10H,1H3,(H,23,24)(H,22,25,27) |
| InChIKey | NTKNOBAIWAWICE-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.95 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|