C17H13NO — CID 25264607
8,10-dimethyl-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaen-11-one (PubChem CID 25264607) has the molecular formula C17H13NO and a molecular weight of 247.30 g/mol. Its IUPAC name is 8,10-dimethyl-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaen-11-one.
| Compound Name | 8,10-dimethyl-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaen-11-one |
|---|---|
| PubChem CID | 25264607 |
| Molecular Formula | C17H13NO |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 8,10-dimethyl-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaen-11-one |
| SMILES | Cc1c2c3c(cccc3c3ccccc13)C(=O)N2C |
| InChI | InChI=1S/C17H13NO/c1-10-11-6-3-4-7-12(11)13-8-5-9-14-15(13)16(10)18(2)17(14)19/h3-9H,1-2H3 |
| InChIKey | OOGVRCOSBUXHTH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|