C19H27N3O — CID 25264656
N-[4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]cyclopropanecarboxamide (PubChem CID 25264656) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is N-[4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 25264656 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | N-[4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]cyclopropanecarboxamide |
| SMILES | CC1CCCN1C1CCN(c2ccc(NC(=O)C3CC3)cc2)C1 |
| InChI | InChI=1S/C19H27N3O/c1-14-3-2-11-22(14)18-10-12-21(13-18)17-8-6-16(7-9-17)20-19(23)15-4-5-15/h6-9,14-15,18H,2-5,10-13H2,1H3,(H,20,23) |
| InChIKey | YJTLIUOYMGJKGP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|