C19H20O2 — CID 25264851
6-ethenyl-6-(4-hydroxyphenyl)-5,7,8,9-tetrahydrobenzo[7]annulen-2-ol (PubChem CID 25264851) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 6-ethenyl-6-(4-hydroxyphenyl)-5,7,8,9-tetrahydrobenzo[7]annulen-2-ol.
| Compound Name | 6-ethenyl-6-(4-hydroxyphenyl)-5,7,8,9-tetrahydrobenzo[7]annulen-2-ol |
|---|---|
| PubChem CID | 25264851 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 6-ethenyl-6-(4-hydroxyphenyl)-5,7,8,9-tetrahydrobenzo[7]annulen-2-ol |
| SMILES | C=CC1(c2ccc(O)cc2)CCCc2cc(O)ccc2C1 |
| InChI | InChI=1S/C19H20O2/c1-2-19(16-6-9-17(20)10-7-16)11-3-4-14-12-18(21)8-5-15(14)13-19/h2,5-10,12,20-21H,1,3-4,11,13H2 |
| InChIKey | KTFYUZLSCBFDNK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|