C23H24FN3O2 — CID 25264907
1-[(4R)-2,2-diethyl-6-fluoro-3,4-dihydrochromen-4-yl]-3-isoquinolin-5-ylurea (PubChem CID 25264907) has the molecular formula C23H24FN3O2 and a molecular weight of 393.46 g/mol. Its IUPAC name is 1-[(4R)-2,2-diethyl-6-fluoro-3,4-dihydrochromen-4-yl]-3-isoquinolin-5-ylurea.
| Compound Name | 1-[(4R)-2,2-diethyl-6-fluoro-3,4-dihydrochromen-4-yl]-3-isoquinolin-5-ylurea |
|---|---|
| PubChem CID | 25264907 |
| Molecular Formula | C23H24FN3O2 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 1-[(4R)-2,2-diethyl-6-fluoro-3,4-dihydrochromen-4-yl]-3-isoquinolin-5-ylurea |
| SMILES | CCC1(CC)C[C@@H](NC(=O)Nc2cccc3cnccc23)c2cc(F)ccc2O1 |
| InChI | InChI=1S/C23H24FN3O2/c1-3-23(4-2)13-20(18-12-16(24)8-9-21(18)29-23)27-22(28)26-19-7-5-6-15-14-25-11-10-17(15)19/h5-12,14,20H,3-4,13H2,1-2H3,(H2,26,27,28)/t20-/m1/s1 |
| InChIKey | SQDHZRJWYDAANI-HXUWFJFHSA-N |
| XLogP | 5.58 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |