C22H33N3O2 — CID 25264945
N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]oxane-4-carboxamide (PubChem CID 25264945) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]oxane-4-carboxamide.
| Compound Name | N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 25264945 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]oxane-4-carboxamide |
| SMILES | Cc1cc(NC(=O)C2CCOCC2)ccc1N1CCC(N2CCCC2C)C1 |
| InChI | InChI=1S/C22H33N3O2/c1-16-14-19(23-22(26)18-8-12-27-13-9-18)5-6-21(16)24-11-7-20(15-24)25-10-3-4-17(25)2/h5-6,14,17-18,20H,3-4,7-13,15H2,1-2H3,(H,23,26) |
| InChIKey | WZFYVAXGOJDHFD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|