C21H19NO5S — CID 25265202
[(1S)-2-anilino-2-oxo-1-phenylethyl] 4-methoxybenzenesulfonate (PubChem CID 25265202) has the molecular formula C21H19NO5S and a molecular weight of 397.45 g/mol. Its IUPAC name is [(1S)-2-anilino-2-oxo-1-phenylethyl] 4-methoxybenzenesulfonate.
| Compound Name | [(1S)-2-anilino-2-oxo-1-phenylethyl] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 25265202 |
| Molecular Formula | C21H19NO5S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | [(1S)-2-anilino-2-oxo-1-phenylethyl] 4-methoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)O[C@H](C(=O)Nc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H19NO5S/c1-26-18-12-14-19(15-13-18)28(24,25)27-20(16-8-4-2-5-9-16)21(23)22-17-10-6-3-7-11-17/h2-15,20H,1H3,(H,22,23)/t20-/m0/s1 |
| InChIKey | JOYXGHVSAPQKOI-FQEVSTJZSA-N |
| XLogP | 3.78 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|