C22H26FN7O2S — CID 25265607
(2R)-2-[[2-[3-(4-fluorophenyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]amino]-3-methylbutan-1-ol (PubChem CID 25265607) has the molecular formula C22H26FN7O2S and a molecular weight of 471.56 g/mol. Its IUPAC name is (2R)-2-[[2-[3-(4-fluorophenyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]amino]-3-methylbutan-1-ol.
| Compound Name | (2R)-2-[[2-[3-(4-fluorophenyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]amino]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 25265607 |
| Molecular Formula | C22H26FN7O2S |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | (2R)-2-[[2-[3-(4-fluorophenyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]amino]-3-methylbutan-1-ol |
| SMILES | CC(C)[C@H](CO)Nc1nc(N2CCn3c(nnc3-c3ccc(F)cc3)C2)nc2c1S(=O)CC2 |
| InChI | InChI=1S/C22H26FN7O2S/c1-13(2)17(12-31)24-20-19-16(7-10-33(19)32)25-22(26-20)29-8-9-30-18(11-29)27-28-21(30)14-3-5-15(23)6-4-14/h3-6,13,17,31H,7-12H2,1-2H3,(H,24,25,26)/t17-,33?/m0/s1 |
| InChIKey | IDHMQOUUPNFJFJ-PELDHITCSA-N |
| XLogP | 1.99 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |