C27H17N3OS — CID 2526582
2-(4-phenylphenyl)-5-(2-thiophen-2-ylquinolin-4-yl)-1,3,4-oxadiazole (PubChem CID 2526582) has the molecular formula C27H17N3OS and a molecular weight of 431.52 g/mol. Its IUPAC name is 2-(4-phenylphenyl)-5-(2-thiophen-2-ylquinolin-4-yl)-1,3,4-oxadiazole.
| Compound Name | 2-(4-phenylphenyl)-5-(2-thiophen-2-ylquinolin-4-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 2526582 |
| Molecular Formula | C27H17N3OS |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 2-(4-phenylphenyl)-5-(2-thiophen-2-ylquinolin-4-yl)-1,3,4-oxadiazole |
| SMILES | c1ccc(-c2ccc(-c3nnc(-c4cc(-c5cccs5)nc5ccccc45)o3)cc2)cc1 |
| InChI | InChI=1S/C27H17N3OS/c1-2-7-18(8-3-1)19-12-14-20(15-13-19)26-29-30-27(31-26)22-17-24(25-11-6-16-32-25)28-23-10-5-4-9-21(22)23/h1-17H |
| InChIKey | NGPLCFNWGGQKDW-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |