About N-cyclohexyl-N-[(2,6-dimethylmorpholin-4-yl)-phenylphosphanyl]cyclohexanamine
N-cyclohexyl-N-[(2,6-dimethylmorpholin-4-yl)-phenylphosphanyl]cyclohexanamine (PubChem CID 25265844) has the molecular formula C24H39N2OP
and a molecular weight of 402.56 g/mol. Its IUPAC name is N-cyclohexyl-N-[(2,6-dimethylmorpholin-4-yl)-phenylphosphanyl]cyclohexanamine.
Molecular Properties
| Compound Name | N-cyclohexyl-N-[(2,6-dimethylmorpholin-4-yl)-phenylphosphanyl]cyclohexanamine |
| PubChem CID | 25265844 |
| Molecular Formula | C24H39N2OP |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | N-cyclohexyl-N-[(2,6-dimethylmorpholin-4-yl)-phenylphosphanyl]cyclohexanamine |
| SMILES | CC1CN(P(c2ccccc2)N(C2CCCCC2)C2CCCCC2)CC(C)O1 |
| InChI | InChI=1S/C24H39N2OP/c1-20-18-25(19-21(2)27-20)28(24-16-10-5-11-17-24)26(22-12-6-3-7-13-22)23-14-8-4-9-15-23/h5,10-11,16-17,20-23H,3-4,6-9,12-15,18-19H2,1-2H3 |
| InChIKey | OTBRGZYWWZSOLY-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexyl-N-[(2,6-dimethylmorpholin-4-yl)-phenylphosphanyl]cyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-N-[(2,6-dimethylmorpholin-4-yl)-phenylphosphanyl]cyclohexanamine?
The IUPAC name of N-cyclohexyl-N-[(2,6-dimethylmorpholin-4-yl)-phenylphosphanyl]cyclohexanamine (CID 25265844) is N-cyclohexyl-N-[(2,6-dimethylmorpholin-4-yl)-phenylphosphanyl]cyclohexanamine.
What is the SMILES notation for N-cyclohexyl-N-[(2,6-dimethylmorpholin-4-yl)-phenylphosphanyl]cyclohexanamine?
The canonical SMILES for N-cyclohexyl-N-[(2,6-dimethylmorpholin-4-yl)-phenylphosphanyl]cyclohexanamine is CC1CN(P(c2ccccc2)N(C2CCCCC2)C2CCCCC2)CC(C)O1.
What is the InChIKey of N-cyclohexyl-N-[(2,6-dimethylmorpholin-4-yl)-phenylphosphanyl]cyclohexanamine?
The InChIKey is OTBRGZYWWZSOLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H39N2OP/c1-20-18-25(19-21(2)27-20)28(24-16-10-5-11-17-24)26(22-12-6-3-7-13-22)23-14-8-4-9-15-23/h5,10-11,16-17,20-23H,3-4,6-9,12-15,18-19H2,1-2H3.
What are the key properties of N-cyclohexyl-N-[(2,6-dimethylmorpholin-4-yl)-phenylphosphanyl]cyclohexanamine?
N-cyclohexyl-N-[(2,6-dimethylmorpholin-4-yl)-phenylphosphanyl]cyclohexanamine has a molecular weight of 402.56 g/mol, XLogP of 5.70, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-N-[(2,6-dimethylmorpholin-4-yl)-phenylphosphanyl]cyclohexanamine is sourced from PubChem (CID 25265844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).