C12H18O3 — CID 25265894
(1S,3S,4S,7S)-7-ethoxy-3-hydroxy-3,4-dimethylbicyclo[2.2.2]oct-5-en-2-one (PubChem CID 25265894) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (1S,3S,4S,7S)-7-ethoxy-3-hydroxy-3,4-dimethylbicyclo[2.2.2]oct-5-en-2-one.
| Compound Name | (1S,3S,4S,7S)-7-ethoxy-3-hydroxy-3,4-dimethylbicyclo[2.2.2]oct-5-en-2-one |
|---|---|
| PubChem CID | 25265894 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (1S,3S,4S,7S)-7-ethoxy-3-hydroxy-3,4-dimethylbicyclo[2.2.2]oct-5-en-2-one |
| SMILES | CCO[C@H]1C[C@@]2(C)C=C[C@@H]1C(=O)[C@@]2(C)O |
| InChI | InChI=1S/C12H18O3/c1-4-15-9-7-11(2)6-5-8(9)10(13)12(11,3)14/h5-6,8-9,14H,4,7H2,1-3H3/t8-,9-,11+,12+/m0/s1 |
| InChIKey | IHPNCHDNZIAEFR-GAIPPQHRSA-N |
| XLogP | 1.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|