C14H20N2O4 — CID 25265934
tert-butyl N-[(1S,2R)-2-nitro-1-phenylpropyl]carbamate (PubChem CID 25265934) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is tert-butyl N-[(1S,2R)-2-nitro-1-phenylpropyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2R)-2-nitro-1-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 25265934 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | tert-butyl N-[(1S,2R)-2-nitro-1-phenylpropyl]carbamate |
| SMILES | C[C@H]([C@@H](NC(=O)OC(C)(C)C)c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C14H20N2O4/c1-10(16(18)19)12(11-8-6-5-7-9-11)15-13(17)20-14(2,3)4/h5-10,12H,1-4H3,(H,15,17)/t10-,12-/m1/s1 |
| InChIKey | XLVMNEBHUHCAFY-ZYHUDNBSSA-N |
| XLogP | 2.92 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|