C24H22F2O2 — CID 25265950
(2R,7S)-2,7-bis(4-fluorophenyl)-3,4,8,9-tetramethylidene-1,6-dioxecane (PubChem CID 25265950) has the molecular formula C24H22F2O2 and a molecular weight of 380.43 g/mol. Its IUPAC name is (2R,7S)-2,7-bis(4-fluorophenyl)-3,4,8,9-tetramethylidene-1,6-dioxecane.
| Compound Name | (2R,7S)-2,7-bis(4-fluorophenyl)-3,4,8,9-tetramethylidene-1,6-dioxecane |
|---|---|
| PubChem CID | 25265950 |
| Molecular Formula | C24H22F2O2 |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | (2R,7S)-2,7-bis(4-fluorophenyl)-3,4,8,9-tetramethylidene-1,6-dioxecane |
| SMILES | C=C1CO[C@H](c2ccc(F)cc2)C(=C)C(=C)CO[C@@H](c2ccc(F)cc2)C1=C |
| InChI | InChI=1S/C24H22F2O2/c1-15-13-27-24(20-7-11-22(26)12-8-20)18(4)16(2)14-28-23(17(15)3)19-5-9-21(25)10-6-19/h5-12,23-24H,1-4,13-14H2/t23-,24+ |
| InChIKey | GVJUAQBJBINRFG-PSWAGMNNSA-N |
| XLogP | 6.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |