About 2-[3-[2-(3,5-difluorophenyl)ethyl]-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid
2-[3-[2-(3,5-difluorophenyl)ethyl]-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid (PubChem CID 25266052) has the molecular formula C27H25F5O2
and a molecular weight of 476.49 g/mol. Its IUPAC name is 2-[3-[2-(3,5-difluorophenyl)ethyl]-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid.
Molecular Properties
| Compound Name | 2-[3-[2-(3,5-difluorophenyl)ethyl]-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid |
| PubChem CID | 25266052 |
| Molecular Formula | C27H25F5O2 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 2-[3-[2-(3,5-difluorophenyl)ethyl]-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(C(=O)O)c1cc(CCc2cc(F)cc(F)c2)cc(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C27H25F5O2/c1-16(2)9-25(26(33)34)21-11-17(3-4-18-12-23(28)15-24(29)13-18)10-20(14-21)19-5-7-22(8-6-19)27(30,31)32/h5-8,10-16,25H,3-4,9H2,1-2H3,(H,33,34) |
| InChIKey | AWWDAXZIFRBWCT-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[3-[2-(3,5-difluorophenyl)ethyl]-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[2-(3,5-difluorophenyl)ethyl]-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid?
The IUPAC name of 2-[3-[2-(3,5-difluorophenyl)ethyl]-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid (CID 25266052) is 2-[3-[2-(3,5-difluorophenyl)ethyl]-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid.
What is the SMILES notation for 2-[3-[2-(3,5-difluorophenyl)ethyl]-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid?
The canonical SMILES for 2-[3-[2-(3,5-difluorophenyl)ethyl]-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid is CC(C)CC(C(=O)O)c1cc(CCc2cc(F)cc(F)c2)cc(-c2ccc(C(F)(F)F)cc2)c1.
What is the InChIKey of 2-[3-[2-(3,5-difluorophenyl)ethyl]-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid?
The InChIKey is AWWDAXZIFRBWCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25F5O2/c1-16(2)9-25(26(33)34)21-11-17(3-4-18-12-23(28)15-24(29)13-18)10-20(14-21)19-5-7-22(8-6-19)27(30,31)32/h5-8,10-16,25H,3-4,9H2,1-2H3,(H,33,34).
What are the key properties of 2-[3-[2-(3,5-difluorophenyl)ethyl]-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid?
2-[3-[2-(3,5-difluorophenyl)ethyl]-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid has a molecular weight of 476.49 g/mol, XLogP of 7.65, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[2-(3,5-difluorophenyl)ethyl]-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid is sourced from PubChem (CID 25266052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).