About 2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-[2-(tritylamino)ethyl]acetamide
2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-[2-(tritylamino)ethyl]acetamide (PubChem CID 25266093) has the molecular formula C29H30N4O4
and a molecular weight of 498.58 g/mol. Its IUPAC name is 2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-[2-(tritylamino)ethyl]acetamide.
Molecular Properties
| Compound Name | 2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-[2-(tritylamino)ethyl]acetamide |
| PubChem CID | 25266093 |
| Molecular Formula | C29H30N4O4 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-[2-(tritylamino)ethyl]acetamide |
| SMILES | O=C(Cn1ccc(=O)[nH]c1=O)N(CCO)CCNC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H30N4O4/c34-21-20-32(27(36)22-33-18-16-26(35)31-28(33)37)19-17-30-29(23-10-4-1-5-11-23,24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-16,18,30,34H,17,19-22H2,(H,31,35,37) |
| InChIKey | AJVQPSILOBTNLL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 107.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-[2-(tritylamino)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-[2-(tritylamino)ethyl]acetamide?
The IUPAC name of 2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-[2-(tritylamino)ethyl]acetamide (CID 25266093) is 2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-[2-(tritylamino)ethyl]acetamide.
What is the SMILES notation for 2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-[2-(tritylamino)ethyl]acetamide?
The canonical SMILES for 2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-[2-(tritylamino)ethyl]acetamide is O=C(Cn1ccc(=O)[nH]c1=O)N(CCO)CCNC(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-[2-(tritylamino)ethyl]acetamide?
The InChIKey is AJVQPSILOBTNLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H30N4O4/c34-21-20-32(27(36)22-33-18-16-26(35)31-28(33)37)19-17-30-29(23-10-4-1-5-11-23,24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-16,18,30,34H,17,19-22H2,(H,31,35,37).
What are the key properties of 2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-[2-(tritylamino)ethyl]acetamide?
2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-[2-(tritylamino)ethyl]acetamide has a molecular weight of 498.58 g/mol, XLogP of 1.94, 11 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-[2-(tritylamino)ethyl]acetamide is sourced from PubChem (CID 25266093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).