C28H33NO2 — CID 25266100
[(2S,6R,7R)-6,7-diphenyl-4-piperidin-1-yl-2-bicyclo[2.2.2]octanyl] prop-2-enoate (PubChem CID 25266100) has the molecular formula C28H33NO2 and a molecular weight of 415.58 g/mol. Its IUPAC name is [(2S,6R,7R)-6,7-diphenyl-4-piperidin-1-yl-2-bicyclo[2.2.2]octanyl] prop-2-enoate.
| Compound Name | [(2S,6R,7R)-6,7-diphenyl-4-piperidin-1-yl-2-bicyclo[2.2.2]octanyl] prop-2-enoate |
|---|---|
| PubChem CID | 25266100 |
| Molecular Formula | C28H33NO2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | [(2S,6R,7R)-6,7-diphenyl-4-piperidin-1-yl-2-bicyclo[2.2.2]octanyl] prop-2-enoate |
| SMILES | C=CC(=O)O[C@H]1CC2(N3CCCCC3)C[C@@H](c3ccccc3)C1[C@H](c1ccccc1)C2 |
| InChI | InChI=1S/C28H33NO2/c1-2-26(30)31-25-20-28(29-16-10-5-11-17-29)18-23(21-12-6-3-7-13-21)27(25)24(19-28)22-14-8-4-9-15-22/h2-4,6-9,12-15,23-25,27H,1,5,10-11,16-20H2/t23-,24-,25-,27?,28?/m0/s1 |
| InChIKey | XINNVJJSEUEEQF-FWBDZRFYSA-N |
| XLogP | 5.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|