C34H30N4O2S — CID 25266135
methyl (5S,8E,9R)-1,3,4,7-tetraphenyl-8-propylidene-6-sulfanylidene-1,2,4,7-tetrazaspiro[4.4]non-2-ene-9-carboxylate (PubChem CID 25266135) has the molecular formula C34H30N4O2S and a molecular weight of 558.71 g/mol. Its IUPAC name is methyl (5S,8E,9R)-1,3,4,7-tetraphenyl-8-propylidene-6-sulfanylidene-1,2,4,7-tetrazaspiro[4.4]non-2-ene-9-carboxylate.
| Compound Name | methyl (5S,8E,9R)-1,3,4,7-tetraphenyl-8-propylidene-6-sulfanylidene-1,2,4,7-tetrazaspiro[4.4]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 25266135 |
| Molecular Formula | C34H30N4O2S |
| Molecular Weight | 558.71 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | methyl (5S,8E,9R)-1,3,4,7-tetraphenyl-8-propylidene-6-sulfanylidene-1,2,4,7-tetrazaspiro[4.4]non-2-ene-9-carboxylate |
| SMILES | CC/C=C1\[C@@H](C(=O)OC)[C@@]2(C(=S)N1c1ccccc1)N(c1ccccc1)N=C(c1ccccc1)N2c1ccccc1 |
| InChI | InChI=1S/C34H30N4O2S/c1-3-16-29-30(32(39)40-2)34(33(41)36(29)26-19-10-5-11-20-26)37(27-21-12-6-13-22-27)31(25-17-8-4-9-18-25)35-38(34)28-23-14-7-15-24-28/h4-24,30H,3H2,1-2H3/b29-16+/t30-,34-/m0/s1 |
| InChIKey | STYGEGKEFGLNHX-RIKAGPDZSA-N |
| XLogP | 7.00 |
| TPSA | 48.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.71 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|