About 5-[2-(3-methoxyanilino)pyrimidin-4-yl]-N,N-dimethyl-4-phenyl-1,3-thiazol-2-amine
5-[2-(3-methoxyanilino)pyrimidin-4-yl]-N,N-dimethyl-4-phenyl-1,3-thiazol-2-amine (PubChem CID 25266166) has the molecular formula C22H21N5OS
and a molecular weight of 403.51 g/mol. Its IUPAC name is 5-[2-(3-methoxyanilino)pyrimidin-4-yl]-N,N-dimethyl-4-phenyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-[2-(3-methoxyanilino)pyrimidin-4-yl]-N,N-dimethyl-4-phenyl-1,3-thiazol-2-amine |
| PubChem CID | 25266166 |
| Molecular Formula | C22H21N5OS |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 5-[2-(3-methoxyanilino)pyrimidin-4-yl]-N,N-dimethyl-4-phenyl-1,3-thiazol-2-amine |
| SMILES | COc1cccc(Nc2nccc(-c3sc(N(C)C)nc3-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C22H21N5OS/c1-27(2)22-26-19(15-8-5-4-6-9-15)20(29-22)18-12-13-23-21(25-18)24-16-10-7-11-17(14-16)28-3/h4-14H,1-3H3,(H,23,24,25) |
| InChIKey | CMLRFSADDBMJLI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[2-(3-methoxyanilino)pyrimidin-4-yl]-N,N-dimethyl-4-phenyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(3-methoxyanilino)pyrimidin-4-yl]-N,N-dimethyl-4-phenyl-1,3-thiazol-2-amine?
The IUPAC name of 5-[2-(3-methoxyanilino)pyrimidin-4-yl]-N,N-dimethyl-4-phenyl-1,3-thiazol-2-amine (CID 25266166) is 5-[2-(3-methoxyanilino)pyrimidin-4-yl]-N,N-dimethyl-4-phenyl-1,3-thiazol-2-amine.
What is the SMILES notation for 5-[2-(3-methoxyanilino)pyrimidin-4-yl]-N,N-dimethyl-4-phenyl-1,3-thiazol-2-amine?
The canonical SMILES for 5-[2-(3-methoxyanilino)pyrimidin-4-yl]-N,N-dimethyl-4-phenyl-1,3-thiazol-2-amine is COc1cccc(Nc2nccc(-c3sc(N(C)C)nc3-c3ccccc3)n2)c1.
What is the InChIKey of 5-[2-(3-methoxyanilino)pyrimidin-4-yl]-N,N-dimethyl-4-phenyl-1,3-thiazol-2-amine?
The InChIKey is CMLRFSADDBMJLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N5OS/c1-27(2)22-26-19(15-8-5-4-6-9-15)20(29-22)18-12-13-23-21(25-18)24-16-10-7-11-17(14-16)28-3/h4-14H,1-3H3,(H,23,24,25).
What are the key properties of 5-[2-(3-methoxyanilino)pyrimidin-4-yl]-N,N-dimethyl-4-phenyl-1,3-thiazol-2-amine?
5-[2-(3-methoxyanilino)pyrimidin-4-yl]-N,N-dimethyl-4-phenyl-1,3-thiazol-2-amine has a molecular weight of 403.51 g/mol, XLogP of 5.09, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(3-methoxyanilino)pyrimidin-4-yl]-N,N-dimethyl-4-phenyl-1,3-thiazol-2-amine is sourced from PubChem (CID 25266166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).