C39H32N4O2S — CID 25266475
methyl 1,3,4,7-tetraphenyl-8-(2-phenylethyl)-6-sulfanylidene-1,2,4,7-tetrazaspiro[4.4]nona-2,8-diene-9-carboxylate (PubChem CID 25266475) has the molecular formula C39H32N4O2S and a molecular weight of 620.78 g/mol. Its IUPAC name is methyl 1,3,4,7-tetraphenyl-8-(2-phenylethyl)-6-sulfanylidene-1,2,4,7-tetrazaspiro[4.4]nona-2,8-diene-9-carboxylate.
| Compound Name | methyl 1,3,4,7-tetraphenyl-8-(2-phenylethyl)-6-sulfanylidene-1,2,4,7-tetrazaspiro[4.4]nona-2,8-diene-9-carboxylate |
|---|---|
| PubChem CID | 25266475 |
| Molecular Formula | C39H32N4O2S |
| Molecular Weight | 620.78 g/mol |
| Exact Mass | 620.22 |
| IUPAC Name | methyl 1,3,4,7-tetraphenyl-8-(2-phenylethyl)-6-sulfanylidene-1,2,4,7-tetrazaspiro[4.4]nona-2,8-diene-9-carboxylate |
| SMILES | COC(=O)C1=C(CCc2ccccc2)N(c2ccccc2)C(=S)C12N(c1ccccc1)N=C(c1ccccc1)N2c1ccccc1 |
| InChI | InChI=1S/C39H32N4O2S/c1-45-37(44)35-34(28-27-29-17-7-2-8-18-29)41(31-21-11-4-12-22-31)38(46)39(35)42(32-23-13-5-14-24-32)36(30-19-9-3-10-20-30)40-43(39)33-25-15-6-16-26-33/h2-26H,27-28H2,1H3 |
| InChIKey | MVSPXMQJRDFNJQ-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 48.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.78 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|