About 7-[2-(tert-butylamino)ethoxy]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-hydroxychromen-4-one
7-[2-(tert-butylamino)ethoxy]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-hydroxychromen-4-one (PubChem CID 25266796) has the molecular formula C23H25NO6
and a molecular weight of 411.45 g/mol. Its IUPAC name is 7-[2-(tert-butylamino)ethoxy]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-hydroxychromen-4-one.
Molecular Properties
| Compound Name | 7-[2-(tert-butylamino)ethoxy]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-hydroxychromen-4-one |
| PubChem CID | 25266796 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 7-[2-(tert-butylamino)ethoxy]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-hydroxychromen-4-one |
| SMILES | CC(C)(C)NCCOc1cc(O)c2c(=O)cc(-c3ccc4c(c3)OCCO4)oc2c1 |
| InChI | InChI=1S/C23H25NO6/c1-23(2,3)24-6-7-27-15-11-16(25)22-17(26)13-19(30-21(22)12-15)14-4-5-18-20(10-14)29-9-8-28-18/h4-5,10-13,24-25H,6-9H2,1-3H3 |
| InChIKey | MYROQWDYUVKYKF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 90.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[2-(tert-butylamino)ethoxy]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-hydroxychromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[2-(tert-butylamino)ethoxy]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-hydroxychromen-4-one?
The IUPAC name of 7-[2-(tert-butylamino)ethoxy]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-hydroxychromen-4-one (CID 25266796) is 7-[2-(tert-butylamino)ethoxy]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-hydroxychromen-4-one.
What is the SMILES notation for 7-[2-(tert-butylamino)ethoxy]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-hydroxychromen-4-one?
The canonical SMILES for 7-[2-(tert-butylamino)ethoxy]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-hydroxychromen-4-one is CC(C)(C)NCCOc1cc(O)c2c(=O)cc(-c3ccc4c(c3)OCCO4)oc2c1.
What is the InChIKey of 7-[2-(tert-butylamino)ethoxy]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-hydroxychromen-4-one?
The InChIKey is MYROQWDYUVKYKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25NO6/c1-23(2,3)24-6-7-27-15-11-16(25)22-17(26)13-19(30-21(22)12-15)14-4-5-18-20(10-14)29-9-8-28-18/h4-5,10-13,24-25H,6-9H2,1-3H3.
What are the key properties of 7-[2-(tert-butylamino)ethoxy]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-hydroxychromen-4-one?
7-[2-(tert-butylamino)ethoxy]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-hydroxychromen-4-one has a molecular weight of 411.45 g/mol, XLogP of 3.70, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[2-(tert-butylamino)ethoxy]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-hydroxychromen-4-one is sourced from PubChem (CID 25266796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).