C35H32N4O2S — CID 25266818
methyl (5R,8E,9R)-8-(2-methylpropylidene)-1,3,4,7-tetraphenyl-6-sulfanylidene-1,2,4,7-tetrazaspiro[4.4]non-2-ene-9-carboxylate (PubChem CID 25266818) has the molecular formula C35H32N4O2S and a molecular weight of 572.73 g/mol. Its IUPAC name is methyl (5R,8E,9R)-8-(2-methylpropylidene)-1,3,4,7-tetraphenyl-6-sulfanylidene-1,2,4,7-tetrazaspiro[4.4]non-2-ene-9-carboxylate.
| Compound Name | methyl (5R,8E,9R)-8-(2-methylpropylidene)-1,3,4,7-tetraphenyl-6-sulfanylidene-1,2,4,7-tetrazaspiro[4.4]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 25266818 |
| Molecular Formula | C35H32N4O2S |
| Molecular Weight | 572.73 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | methyl (5R,8E,9R)-8-(2-methylpropylidene)-1,3,4,7-tetraphenyl-6-sulfanylidene-1,2,4,7-tetrazaspiro[4.4]non-2-ene-9-carboxylate |
| SMILES | COC(=O)[C@@H]1/C(=C\C(C)C)N(c2ccccc2)C(=S)[C@]12N(c1ccccc1)N=C(c1ccccc1)N2c1ccccc1 |
| InChI | InChI=1S/C35H32N4O2S/c1-25(2)24-30-31(33(40)41-3)35(34(42)37(30)27-18-10-5-11-19-27)38(28-20-12-6-13-21-28)32(26-16-8-4-9-17-26)36-39(35)29-22-14-7-15-23-29/h4-25,31H,1-3H3/b30-24+/t31-,35+/m0/s1 |
| InChIKey | QRTJTRZKUVPPMK-WFPUTSQXSA-N |
| XLogP | 7.25 |
| TPSA | 48.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.73 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|