C25H30N6O — CID 25266935
N-[2-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 25266935) has the molecular formula C25H30N6O and a molecular weight of 430.56 g/mol. Its IUPAC name is N-[2-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-[2-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 25266935 |
| Molecular Formula | C25H30N6O |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | N-[2-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | Cc1cc(N2CCC(N3CCCC3C)C2)ccc1NC(=O)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C25H30N6O/c1-18-14-22(29-13-11-23(15-29)30-12-3-4-19(30)2)9-10-24(18)28-25(32)20-5-7-21(8-6-20)31-17-26-16-27-31/h5-10,14,16-17,19,23H,3-4,11-13,15H2,1-2H3,(H,28,32) |
| InChIKey | KAYQBTYXKUYJFY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|