About 2-butylsulfanyl-4-(dimethylamino)-8-[(4-fluorophenyl)methyl]-5H-pteridine-6,7-dione
2-butylsulfanyl-4-(dimethylamino)-8-[(4-fluorophenyl)methyl]-5H-pteridine-6,7-dione (PubChem CID 25267260) has the molecular formula C19H22FN5O2S
and a molecular weight of 403.48 g/mol. Its IUPAC name is 2-butylsulfanyl-4-(dimethylamino)-8-[(4-fluorophenyl)methyl]-5H-pteridine-6,7-dione.
Molecular Properties
| Compound Name | 2-butylsulfanyl-4-(dimethylamino)-8-[(4-fluorophenyl)methyl]-5H-pteridine-6,7-dione |
| PubChem CID | 25267260 |
| Molecular Formula | C19H22FN5O2S |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 2-butylsulfanyl-4-(dimethylamino)-8-[(4-fluorophenyl)methyl]-5H-pteridine-6,7-dione |
| SMILES | CCCCSc1nc(N(C)C)c2[nH]c(=O)c(=O)n(Cc3ccc(F)cc3)c2n1 |
| InChI | InChI=1S/C19H22FN5O2S/c1-4-5-10-28-19-22-15(24(2)3)14-16(23-19)25(18(27)17(26)21-14)11-12-6-8-13(20)9-7-12/h6-9H,4-5,10-11H2,1-3H3,(H,21,26) |
| InChIKey | UCLRXYWILWWQOP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-butylsulfanyl-4-(dimethylamino)-8-[(4-fluorophenyl)methyl]-5H-pteridine-6,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylsulfanyl-4-(dimethylamino)-8-[(4-fluorophenyl)methyl]-5H-pteridine-6,7-dione?
The IUPAC name of 2-butylsulfanyl-4-(dimethylamino)-8-[(4-fluorophenyl)methyl]-5H-pteridine-6,7-dione (CID 25267260) is 2-butylsulfanyl-4-(dimethylamino)-8-[(4-fluorophenyl)methyl]-5H-pteridine-6,7-dione.
What is the SMILES notation for 2-butylsulfanyl-4-(dimethylamino)-8-[(4-fluorophenyl)methyl]-5H-pteridine-6,7-dione?
The canonical SMILES for 2-butylsulfanyl-4-(dimethylamino)-8-[(4-fluorophenyl)methyl]-5H-pteridine-6,7-dione is CCCCSc1nc(N(C)C)c2[nH]c(=O)c(=O)n(Cc3ccc(F)cc3)c2n1.
What is the InChIKey of 2-butylsulfanyl-4-(dimethylamino)-8-[(4-fluorophenyl)methyl]-5H-pteridine-6,7-dione?
The InChIKey is UCLRXYWILWWQOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22FN5O2S/c1-4-5-10-28-19-22-15(24(2)3)14-16(23-19)25(18(27)17(26)21-14)11-12-6-8-13(20)9-7-12/h6-9H,4-5,10-11H2,1-3H3,(H,21,26).
What are the key properties of 2-butylsulfanyl-4-(dimethylamino)-8-[(4-fluorophenyl)methyl]-5H-pteridine-6,7-dione?
2-butylsulfanyl-4-(dimethylamino)-8-[(4-fluorophenyl)methyl]-5H-pteridine-6,7-dione has a molecular weight of 403.48 g/mol, XLogP of 2.63, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylsulfanyl-4-(dimethylamino)-8-[(4-fluorophenyl)methyl]-5H-pteridine-6,7-dione is sourced from PubChem (CID 25267260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).