C34H31FN4O5S2 — CID 25267436
1-N'-[3-fluoro-4-[2-[4-[(2-methylsulfonylethylamino)methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-N-phenylcyclopropane-1,1-dicarboxamide (PubChem CID 25267436) has the molecular formula C34H31FN4O5S2 and a molecular weight of 658.78 g/mol. Its IUPAC name is 1-N'-[3-fluoro-4-[2-[4-[(2-methylsulfonylethylamino)methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-N-phenylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[3-fluoro-4-[2-[4-[(2-methylsulfonylethylamino)methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-N-phenylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 25267436 |
| Molecular Formula | C34H31FN4O5S2 |
| Molecular Weight | 658.78 g/mol |
| Exact Mass | 658.17 |
| IUPAC Name | 1-N'-[3-fluoro-4-[2-[4-[(2-methylsulfonylethylamino)methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-N-phenylcyclopropane-1,1-dicarboxamide |
| SMILES | CS(=O)(=O)CCNCc1ccc(-c2cc3nccc(Oc4ccc(NC(=O)C5(C(=O)Nc6ccccc6)CC5)cc4F)c3s2)cc1 |
| InChI | InChI=1S/C34H31FN4O5S2/c1-46(42,43)18-17-36-21-22-7-9-23(10-8-22)30-20-27-31(45-30)29(13-16-37-27)44-28-12-11-25(19-26(28)35)39-33(41)34(14-15-34)32(40)38-24-5-3-2-4-6-24/h2-13,16,19-20,36H,14-15,17-18,21H2,1H3,(H,38,40)(H,39,41) |
| InChIKey | ODGPTSSUCJICHM-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.78 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|