C18H18N2O4 — CID 25267808
ethyl 2,6-dioxo-1,7-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-10(17),11,13,15-tetraene-5-carboxylate (PubChem CID 25267808) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is ethyl 2,6-dioxo-1,7-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-10(17),11,13,15-tetraene-5-carboxylate.
| Compound Name | ethyl 2,6-dioxo-1,7-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-10(17),11,13,15-tetraene-5-carboxylate |
|---|---|
| PubChem CID | 25267808 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | ethyl 2,6-dioxo-1,7-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-10(17),11,13,15-tetraene-5-carboxylate |
| SMILES | CCOC(=O)C12CCC(=O)n3c1c(c1ccccc13)CCNC2=O |
| InChI | InChI=1S/C18H18N2O4/c1-2-24-17(23)18-9-7-14(21)20-13-6-4-3-5-11(13)12(15(18)20)8-10-19-16(18)22/h3-6H,2,7-10H2,1H3,(H,19,22) |
| InChIKey | PPVOZBRYJMIFMQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|