C18H28O4 — CID 25267900
methyl (3'aS,6'R,7'aS)-6'-ethyl-5,5-dimethylspiro[1,3-dioxane-2,1'-2,3,3a,6,7,7a-hexahydroindene]-4'-carboxylate (PubChem CID 25267900) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is methyl (3'aS,6'R,7'aS)-6'-ethyl-5,5-dimethylspiro[1,3-dioxane-2,1'-2,3,3a,6,7,7a-hexahydroindene]-4'-carboxylate.
| Compound Name | methyl (3'aS,6'R,7'aS)-6'-ethyl-5,5-dimethylspiro[1,3-dioxane-2,1'-2,3,3a,6,7,7a-hexahydroindene]-4'-carboxylate |
|---|---|
| PubChem CID | 25267900 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | methyl (3'aS,6'R,7'aS)-6'-ethyl-5,5-dimethylspiro[1,3-dioxane-2,1'-2,3,3a,6,7,7a-hexahydroindene]-4'-carboxylate |
| SMILES | CC[C@H]1C=C(C(=O)OC)[C@H]2CCC3(OCC(C)(C)CO3)[C@H]2C1 |
| InChI | InChI=1S/C18H28O4/c1-5-12-8-14(16(19)20-4)13-6-7-18(15(13)9-12)21-10-17(2,3)11-22-18/h8,12-13,15H,5-7,9-11H2,1-4H3/t12-,13+,15-/m0/s1 |
| InChIKey | YOGGPDWRDOABJC-GUTXKFCHSA-N |
| XLogP | 3.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |