C32H28F2N4O5S — CID 25268135
1-N'-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]furan-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 25268135) has the molecular formula C32H28F2N4O5S and a molecular weight of 618.66 g/mol. Its IUPAC name is 1-N'-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]furan-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]furan-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 25268135 |
| Molecular Formula | C32H28F2N4O5S |
| Molecular Weight | 618.66 g/mol |
| Exact Mass | 618.17 |
| IUPAC Name | 1-N'-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]furan-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | COCCNCc1ccc(-c2cc3nccc(Oc4ccc(NC(=O)C5(C(=O)Nc6ccc(F)cc6)CC5)cc4F)c3s2)o1 |
| InChI | InChI=1S/C32H28F2N4O5S/c1-41-15-14-35-18-22-7-9-26(42-22)28-17-24-29(44-28)27(10-13-36-24)43-25-8-6-21(16-23(25)34)38-31(40)32(11-12-32)30(39)37-20-4-2-19(33)3-5-20/h2-10,13,16-17,35H,11-12,14-15,18H2,1H3,(H,37,39)(H,38,40) |
| InChIKey | ZRRYYVJYBGDNKG-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.66 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|