C48H54O15 — CID 25268305
[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[(1R,2S,3S,4R,5R,6S)-2-hydroxy-3,4,5,6-tetrakis(phenylmethoxy)cyclohexyl]oxyoxan-2-yl]methyl acetate (PubChem CID 25268305) has the molecular formula C48H54O15 and a molecular weight of 870.95 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[(1R,2S,3S,4R,5R,6S)-2-hydroxy-3,4,5,6-tetrakis(phenylmethoxy)cyclohexyl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[(1R,2S,3S,4R,5R,6S)-2-hydroxy-3,4,5,6-tetrakis(phenylmethoxy)cyclohexyl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 25268305 |
| Molecular Formula | C48H54O15 |
| Molecular Weight | 870.95 g/mol |
| Exact Mass | 870.35 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[(1R,2S,3S,4R,5R,6S)-2-hydroxy-3,4,5,6-tetrakis(phenylmethoxy)cyclohexyl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C48H54O15/c1-30(49)54-29-38-40(59-31(2)50)46(60-32(3)51)47(61-33(4)52)48(62-38)63-42-39(53)41(55-25-34-17-9-5-10-18-34)43(56-26-35-19-11-6-12-20-35)45(58-28-37-23-15-8-16-24-37)44(42)57-27-36-21-13-7-14-22-36/h5-24,38-48,53H,25-29H2,1-4H3/t38-,39+,40-,41+,42-,43-,44-,45-,46+,47+,48-/m1/s1 |
| InChIKey | ILHHOHBIFRGWQN-CIXWYHHYSA-N |
| XLogP | 5.17 |
| TPSA | 180.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.95 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|