About [4-(5-tert-butyl-1,3-benzoxazol-2-yl)-1,4-diazepan-1-yl]-morpholin-4-ylmethanone
[4-(5-tert-butyl-1,3-benzoxazol-2-yl)-1,4-diazepan-1-yl]-morpholin-4-ylmethanone (PubChem CID 25268512) has the molecular formula C21H30N4O3
and a molecular weight of 386.50 g/mol. Its IUPAC name is [4-(5-tert-butyl-1,3-benzoxazol-2-yl)-1,4-diazepan-1-yl]-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [4-(5-tert-butyl-1,3-benzoxazol-2-yl)-1,4-diazepan-1-yl]-morpholin-4-ylmethanone |
| PubChem CID | 25268512 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | [4-(5-tert-butyl-1,3-benzoxazol-2-yl)-1,4-diazepan-1-yl]-morpholin-4-ylmethanone |
| SMILES | CC(C)(C)c1ccc2oc(N3CCCN(C(=O)N4CCOCC4)CC3)nc2c1 |
| InChI | InChI=1S/C21H30N4O3/c1-21(2,3)16-5-6-18-17(15-16)22-19(28-18)23-7-4-8-24(10-9-23)20(26)25-11-13-27-14-12-25/h5-6,15H,4,7-14H2,1-3H3 |
| InChIKey | HNTCFIAPESSKNV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 62.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(5-tert-butyl-1,3-benzoxazol-2-yl)-1,4-diazepan-1-yl]-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-tert-butyl-1,3-benzoxazol-2-yl)-1,4-diazepan-1-yl]-morpholin-4-ylmethanone?
The IUPAC name of [4-(5-tert-butyl-1,3-benzoxazol-2-yl)-1,4-diazepan-1-yl]-morpholin-4-ylmethanone (CID 25268512) is [4-(5-tert-butyl-1,3-benzoxazol-2-yl)-1,4-diazepan-1-yl]-morpholin-4-ylmethanone.
What is the SMILES notation for [4-(5-tert-butyl-1,3-benzoxazol-2-yl)-1,4-diazepan-1-yl]-morpholin-4-ylmethanone?
The canonical SMILES for [4-(5-tert-butyl-1,3-benzoxazol-2-yl)-1,4-diazepan-1-yl]-morpholin-4-ylmethanone is CC(C)(C)c1ccc2oc(N3CCCN(C(=O)N4CCOCC4)CC3)nc2c1.
What is the InChIKey of [4-(5-tert-butyl-1,3-benzoxazol-2-yl)-1,4-diazepan-1-yl]-morpholin-4-ylmethanone?
The InChIKey is HNTCFIAPESSKNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30N4O3/c1-21(2,3)16-5-6-18-17(15-16)22-19(28-18)23-7-4-8-24(10-9-23)20(26)25-11-13-27-14-12-25/h5-6,15H,4,7-14H2,1-3H3.
What are the key properties of [4-(5-tert-butyl-1,3-benzoxazol-2-yl)-1,4-diazepan-1-yl]-morpholin-4-ylmethanone?
[4-(5-tert-butyl-1,3-benzoxazol-2-yl)-1,4-diazepan-1-yl]-morpholin-4-ylmethanone has a molecular weight of 386.50 g/mol, XLogP of 3.09, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-tert-butyl-1,3-benzoxazol-2-yl)-1,4-diazepan-1-yl]-morpholin-4-ylmethanone is sourced from PubChem (CID 25268512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).