C40H34N4O2S — CID 25268975
methyl (5S,8E,9R)-3-(4-methylphenyl)-1,4,7-triphenyl-8-(2-phenylethylidene)-6-sulfanylidene-1,2,4,7-tetrazaspiro[4.4]non-2-ene-9-carboxylate (PubChem CID 25268975) has the molecular formula C40H34N4O2S and a molecular weight of 634.81 g/mol. Its IUPAC name is methyl (5S,8E,9R)-3-(4-methylphenyl)-1,4,7-triphenyl-8-(2-phenylethylidene)-6-sulfanylidene-1,2,4,7-tetrazaspiro[4.4]non-2-ene-9-carboxylate.
| Compound Name | methyl (5S,8E,9R)-3-(4-methylphenyl)-1,4,7-triphenyl-8-(2-phenylethylidene)-6-sulfanylidene-1,2,4,7-tetrazaspiro[4.4]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 25268975 |
| Molecular Formula | C40H34N4O2S |
| Molecular Weight | 634.81 g/mol |
| Exact Mass | 634.24 |
| IUPAC Name | methyl (5S,8E,9R)-3-(4-methylphenyl)-1,4,7-triphenyl-8-(2-phenylethylidene)-6-sulfanylidene-1,2,4,7-tetrazaspiro[4.4]non-2-ene-9-carboxylate |
| SMILES | COC(=O)[C@@H]1/C(=C\Cc2ccccc2)N(c2ccccc2)C(=S)[C@@]12N(c1ccccc1)N=C(c1ccc(C)cc1)N2c1ccccc1 |
| InChI | InChI=1S/C40H34N4O2S/c1-29-23-26-31(27-24-29)37-41-44(34-21-13-6-14-22-34)40(43(37)33-19-11-5-12-20-33)36(38(45)46-2)35(28-25-30-15-7-3-8-16-30)42(39(40)47)32-17-9-4-10-18-32/h3-24,26-28,36H,25H2,1-2H3/b35-28+/t36-,40-/m0/s1 |
| InChIKey | WSZBUYGWGHBALI-CGFNXNRXSA-N |
| XLogP | 8.14 |
| TPSA | 48.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.81 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|