C21H22N2O2 — CID 25269098
(E)-3-[4-[(E)-3-(cyclopropylamino)-2-phenylprop-1-enyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 25269098) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is (E)-3-[4-[(E)-3-(cyclopropylamino)-2-phenylprop-1-enyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[4-[(E)-3-(cyclopropylamino)-2-phenylprop-1-enyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 25269098 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (E)-3-[4-[(E)-3-(cyclopropylamino)-2-phenylprop-1-enyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(/C=C(/CNC2CC2)c2ccccc2)cc1)NO |
| InChI | InChI=1S/C21H22N2O2/c24-21(23-25)13-10-16-6-8-17(9-7-16)14-19(15-22-20-11-12-20)18-4-2-1-3-5-18/h1-10,13-14,20,22,25H,11-12,15H2,(H,23,24)/b13-10+,19-14- |
| InChIKey | MSVKCELXTYNZEY-ANMLQGLPSA-N |
| XLogP | 3.50 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|