About 5-(2-chlorophenyl)-3-(4-chlorophenyl)-1,4,2-dioxazole
5-(2-chlorophenyl)-3-(4-chlorophenyl)-1,4,2-dioxazole (PubChem CID 25269299) has the molecular formula C14H9Cl2NO2
and a molecular weight of 294.14 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-3-(4-chlorophenyl)-1,4,2-dioxazole.
Molecular Properties
| Compound Name | 5-(2-chlorophenyl)-3-(4-chlorophenyl)-1,4,2-dioxazole |
| PubChem CID | 25269299 |
| Molecular Formula | C14H9Cl2NO2 |
| Molecular Weight | 294.14 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 5-(2-chlorophenyl)-3-(4-chlorophenyl)-1,4,2-dioxazole |
| SMILES | Clc1ccc(C2=NOC(c3ccccc3Cl)O2)cc1 |
| InChI | InChI=1S/C14H9Cl2NO2/c15-10-7-5-9(6-8-10)13-17-19-14(18-13)11-3-1-2-4-12(11)16/h1-8,14H |
| InChIKey | BIUVSJVOYHXIQI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.14 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(2-chlorophenyl)-3-(4-chlorophenyl)-1,4,2-dioxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-chlorophenyl)-3-(4-chlorophenyl)-1,4,2-dioxazole?
The IUPAC name of 5-(2-chlorophenyl)-3-(4-chlorophenyl)-1,4,2-dioxazole (CID 25269299) is 5-(2-chlorophenyl)-3-(4-chlorophenyl)-1,4,2-dioxazole.
What is the SMILES notation for 5-(2-chlorophenyl)-3-(4-chlorophenyl)-1,4,2-dioxazole?
The canonical SMILES for 5-(2-chlorophenyl)-3-(4-chlorophenyl)-1,4,2-dioxazole is Clc1ccc(C2=NOC(c3ccccc3Cl)O2)cc1.
What is the InChIKey of 5-(2-chlorophenyl)-3-(4-chlorophenyl)-1,4,2-dioxazole?
The InChIKey is BIUVSJVOYHXIQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9Cl2NO2/c15-10-7-5-9(6-8-10)13-17-19-14(18-13)11-3-1-2-4-12(11)16/h1-8,14H.
What are the key properties of 5-(2-chlorophenyl)-3-(4-chlorophenyl)-1,4,2-dioxazole?
5-(2-chlorophenyl)-3-(4-chlorophenyl)-1,4,2-dioxazole has a molecular weight of 294.14 g/mol, XLogP of 4.40, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-chlorophenyl)-3-(4-chlorophenyl)-1,4,2-dioxazole is sourced from PubChem (CID 25269299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).