C10H13ClO8 — CID 25269359
[(2S,3S,4S,5S,6S)-2-(chloromethyl)-4,5-diformyloxy-6-methoxyoxan-3-yl] formate (PubChem CID 25269359) has the molecular formula C10H13ClO8 and a molecular weight of 296.66 g/mol. Its IUPAC name is [(2S,3S,4S,5S,6S)-2-(chloromethyl)-4,5-diformyloxy-6-methoxyoxan-3-yl] formate.
| Compound Name | [(2S,3S,4S,5S,6S)-2-(chloromethyl)-4,5-diformyloxy-6-methoxyoxan-3-yl] formate |
|---|---|
| PubChem CID | 25269359 |
| Molecular Formula | C10H13ClO8 |
| Molecular Weight | 296.66 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | [(2S,3S,4S,5S,6S)-2-(chloromethyl)-4,5-diformyloxy-6-methoxyoxan-3-yl] formate |
| SMILES | CO[C@H]1O[C@H](CCl)[C@@H](OC=O)[C@H](OC=O)[C@@H]1OC=O |
| InChI | InChI=1S/C10H13ClO8/c1-15-10-9(18-5-14)8(17-4-13)7(16-3-12)6(2-11)19-10/h3-10H,2H2,1H3/t6-,7-,8+,9+,10+/m1/s1 |
| InChIKey | UOGBASOOQKLQJM-ZJDVBMNYSA-N |
| XLogP | -0.78 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.66 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|