About ethyl 2-[5-(1-adamantylmethylcarbamoyl)imidazo[1,2-a]pyridin-2-yl]acetate
ethyl 2-[5-(1-adamantylmethylcarbamoyl)imidazo[1,2-a]pyridin-2-yl]acetate (PubChem CID 25269403) has the molecular formula C23H29N3O3
and a molecular weight of 395.50 g/mol. Its IUPAC name is ethyl 2-[5-(1-adamantylmethylcarbamoyl)imidazo[1,2-a]pyridin-2-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[5-(1-adamantylmethylcarbamoyl)imidazo[1,2-a]pyridin-2-yl]acetate |
| PubChem CID | 25269403 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | ethyl 2-[5-(1-adamantylmethylcarbamoyl)imidazo[1,2-a]pyridin-2-yl]acetate |
| SMILES | CCOC(=O)Cc1cn2c(C(=O)NCC34CC5CC(CC(C5)C3)C4)cccc2n1 |
| InChI | InChI=1S/C23H29N3O3/c1-2-29-21(27)9-18-13-26-19(4-3-5-20(26)25-18)22(28)24-14-23-10-15-6-16(11-23)8-17(7-15)12-23/h3-5,13,15-17H,2,6-12,14H2,1H3,(H,24,28) |
| InChIKey | KDVYIZPBDFTGNP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-[5-(1-adamantylmethylcarbamoyl)imidazo[1,2-a]pyridin-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[5-(1-adamantylmethylcarbamoyl)imidazo[1,2-a]pyridin-2-yl]acetate?
The IUPAC name of ethyl 2-[5-(1-adamantylmethylcarbamoyl)imidazo[1,2-a]pyridin-2-yl]acetate (CID 25269403) is ethyl 2-[5-(1-adamantylmethylcarbamoyl)imidazo[1,2-a]pyridin-2-yl]acetate.
What is the SMILES notation for ethyl 2-[5-(1-adamantylmethylcarbamoyl)imidazo[1,2-a]pyridin-2-yl]acetate?
The canonical SMILES for ethyl 2-[5-(1-adamantylmethylcarbamoyl)imidazo[1,2-a]pyridin-2-yl]acetate is CCOC(=O)Cc1cn2c(C(=O)NCC34CC5CC(CC(C5)C3)C4)cccc2n1.
What is the InChIKey of ethyl 2-[5-(1-adamantylmethylcarbamoyl)imidazo[1,2-a]pyridin-2-yl]acetate?
The InChIKey is KDVYIZPBDFTGNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29N3O3/c1-2-29-21(27)9-18-13-26-19(4-3-5-20(26)25-18)22(28)24-14-23-10-15-6-16(11-23)8-17(7-15)12-23/h3-5,13,15-17H,2,6-12,14H2,1H3,(H,24,28).
What are the key properties of ethyl 2-[5-(1-adamantylmethylcarbamoyl)imidazo[1,2-a]pyridin-2-yl]acetate?
ethyl 2-[5-(1-adamantylmethylcarbamoyl)imidazo[1,2-a]pyridin-2-yl]acetate has a molecular weight of 395.50 g/mol, XLogP of 3.39, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[5-(1-adamantylmethylcarbamoyl)imidazo[1,2-a]pyridin-2-yl]acetate is sourced from PubChem (CID 25269403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).