C12H17N5O6S — CID 25269754
4-(4,6-dimethoxypyrimidin-2-yl)-N,N-dimethyl-3,5-dioxopiperazine-1-sulfonamide (PubChem CID 25269754) has the molecular formula C12H17N5O6S and a molecular weight of 359.36 g/mol. Its IUPAC name is 4-(4,6-dimethoxypyrimidin-2-yl)-N,N-dimethyl-3,5-dioxopiperazine-1-sulfonamide.
| Compound Name | 4-(4,6-dimethoxypyrimidin-2-yl)-N,N-dimethyl-3,5-dioxopiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 25269754 |
| Molecular Formula | C12H17N5O6S |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 4-(4,6-dimethoxypyrimidin-2-yl)-N,N-dimethyl-3,5-dioxopiperazine-1-sulfonamide |
| SMILES | COc1cc(OC)nc(N2C(=O)CN(S(=O)(=O)N(C)C)CC2=O)n1 |
| InChI | InChI=1S/C12H17N5O6S/c1-15(2)24(20,21)16-6-10(18)17(11(19)7-16)12-13-8(22-3)5-9(14-12)23-4/h5H,6-7H2,1-4H3 |
| InChIKey | ULLKEYOKRIRLBL-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 122.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|