About cyclohexyl-[[4-[(2,5-dichlorobenzoyl)amino]phenyl]methyl]-dimethylazanium chloride
cyclohexyl-[[4-[(2,5-dichlorobenzoyl)amino]phenyl]methyl]-dimethylazanium chloride (PubChem CID 25269862) has the molecular formula C22H27Cl3N2O
and a molecular weight of 441.83 g/mol. Its IUPAC name is cyclohexyl-[[4-[(2,5-dichlorobenzoyl)amino]phenyl]methyl]-dimethylazanium chloride.
Molecular Properties
| Compound Name | cyclohexyl-[[4-[(2,5-dichlorobenzoyl)amino]phenyl]methyl]-dimethylazanium chloride |
| PubChem CID | 25269862 |
| Molecular Formula | C22H27Cl3N2O |
| Molecular Weight | 441.83 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | cyclohexyl-[[4-[(2,5-dichlorobenzoyl)amino]phenyl]methyl]-dimethylazanium chloride |
| SMILES | C[N+](C)(Cc1ccc(NC(=O)c2cc(Cl)ccc2Cl)cc1)C1CCCCC1.[Cl-] |
| InChI | InChI=1S/C22H26Cl2N2O.ClH/c1-26(2,19-6-4-3-5-7-19)15-16-8-11-18(12-9-16)25-22(27)20-14-17(23)10-13-21(20)24;/h8-14,19H,3-7,15H2,1-2H3;1H |
| InChIKey | HTWPJVPFOHEYAF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.83 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl-[[4-[(2,5-dichlorobenzoyl)amino]phenyl]methyl]-dimethylazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-[[4-[(2,5-dichlorobenzoyl)amino]phenyl]methyl]-dimethylazanium chloride?
The IUPAC name of cyclohexyl-[[4-[(2,5-dichlorobenzoyl)amino]phenyl]methyl]-dimethylazanium chloride (CID 25269862) is cyclohexyl-[[4-[(2,5-dichlorobenzoyl)amino]phenyl]methyl]-dimethylazanium chloride.
What is the SMILES notation for cyclohexyl-[[4-[(2,5-dichlorobenzoyl)amino]phenyl]methyl]-dimethylazanium chloride?
The canonical SMILES for cyclohexyl-[[4-[(2,5-dichlorobenzoyl)amino]phenyl]methyl]-dimethylazanium chloride is C[N+](C)(Cc1ccc(NC(=O)c2cc(Cl)ccc2Cl)cc1)C1CCCCC1.[Cl-].
What is the InChIKey of cyclohexyl-[[4-[(2,5-dichlorobenzoyl)amino]phenyl]methyl]-dimethylazanium chloride?
The InChIKey is HTWPJVPFOHEYAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26Cl2N2O.ClH/c1-26(2,19-6-4-3-5-7-19)15-16-8-11-18(12-9-16)25-22(27)20-14-17(23)10-13-21(20)24;/h8-14,19H,3-7,15H2,1-2H3;1H.
What are the key properties of cyclohexyl-[[4-[(2,5-dichlorobenzoyl)amino]phenyl]methyl]-dimethylazanium chloride?
cyclohexyl-[[4-[(2,5-dichlorobenzoyl)amino]phenyl]methyl]-dimethylazanium chloride has a molecular weight of 441.83 g/mol, XLogP of 3.16, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-[[4-[(2,5-dichlorobenzoyl)amino]phenyl]methyl]-dimethylazanium chloride is sourced from PubChem (CID 25269862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).