C26H32FN5O2S — CID 25269910
2-[4-(2-ethyl-5-fluoro-1H-indol-3-yl)piperidin-1-yl]-N-(oxan-4-yl)-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine (PubChem CID 25269910) has the molecular formula C26H32FN5O2S and a molecular weight of 497.64 g/mol. Its IUPAC name is 2-[4-(2-ethyl-5-fluoro-1H-indol-3-yl)piperidin-1-yl]-N-(oxan-4-yl)-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine.
| Compound Name | 2-[4-(2-ethyl-5-fluoro-1H-indol-3-yl)piperidin-1-yl]-N-(oxan-4-yl)-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 25269910 |
| Molecular Formula | C26H32FN5O2S |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | 2-[4-(2-ethyl-5-fluoro-1H-indol-3-yl)piperidin-1-yl]-N-(oxan-4-yl)-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine |
| SMILES | CCc1[nH]c2ccc(F)cc2c1C1CCN(c2nc3c(c(NC4CCOCC4)n2)S(=O)CC3)CC1 |
| InChI | InChI=1S/C26H32FN5O2S/c1-2-20-23(19-15-17(27)3-4-21(19)29-20)16-5-10-32(11-6-16)26-30-22-9-14-35(33)24(22)25(31-26)28-18-7-12-34-13-8-18/h3-4,15-16,18,29H,2,5-14H2,1H3,(H,28,30,31) |
| InChIKey | CJRYZPYLUHWAIK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|