C22H28O2 — CID 25269954
(8R,9S,13S,14S,17S)-13-methylspiro[7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17,6'-oxane]-2'-one (PubChem CID 25269954) has the molecular formula C22H28O2 and a molecular weight of 324.46 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-13-methylspiro[7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17,6'-oxane]-2'-one.
| Compound Name | (8R,9S,13S,14S,17S)-13-methylspiro[7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17,6'-oxane]-2'-one |
|---|---|
| PubChem CID | 25269954 |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | (8R,9S,13S,14S,17S)-13-methylspiro[7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17,6'-oxane]-2'-one |
| SMILES | C[C@]12CC[C@@H]3c4ccccc4CC[C@H]3[C@@H]1CC[C@@]21CCCC(=O)O1 |
| InChI | InChI=1S/C22H28O2/c1-21-13-10-17-16-6-3-2-5-15(16)8-9-18(17)19(21)11-14-22(21)12-4-7-20(23)24-22/h2-3,5-6,17-19H,4,7-14H2,1H3/t17-,18-,19+,21+,22+/m1/s1 |
| InChIKey | JFEVGYBOFUOWOA-DGYCAGFBSA-N |
| XLogP | 5.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |