C22H30O3 — CID 25269984
(5E,7E,9E)-17-(oxan-2-yloxy)heptadeca-5,7,9-trien-11,13-diyn-4-ol (PubChem CID 25269984) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is (5E,7E,9E)-17-(oxan-2-yloxy)heptadeca-5,7,9-trien-11,13-diyn-4-ol.
| Compound Name | (5E,7E,9E)-17-(oxan-2-yloxy)heptadeca-5,7,9-trien-11,13-diyn-4-ol |
|---|---|
| PubChem CID | 25269984 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (5E,7E,9E)-17-(oxan-2-yloxy)heptadeca-5,7,9-trien-11,13-diyn-4-ol |
| SMILES | CCCC(O)/C=C/C=C/C=C/C#CC#CCCCOC1CCCCO1 |
| InChI | InChI=1S/C22H30O3/c1-2-16-21(23)17-12-10-8-6-4-3-5-7-9-11-14-19-24-22-18-13-15-20-25-22/h4,6,8,10,12,17,21-23H,2,11,13-16,18-20H2,1H3/b6-4+,10-8+,17-12+ |
| InChIKey | XDWUUDZZXOJKNB-UOQAZIJVSA-N |
| XLogP | 4.15 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|