C19H15F3N2OS2 — CID 25269989
(Z,1Z)-4-(1-benzothiophen-2-yl)-1-(dimethylhydrazinylidene)-5,5,5-trifluoro-1-thiophen-2-ylpent-3-en-2-one (PubChem CID 25269989) has the molecular formula C19H15F3N2OS2 and a molecular weight of 408.47 g/mol. Its IUPAC name is (Z,1Z)-4-(1-benzothiophen-2-yl)-1-(dimethylhydrazinylidene)-5,5,5-trifluoro-1-thiophen-2-ylpent-3-en-2-one.
| Compound Name | (Z,1Z)-4-(1-benzothiophen-2-yl)-1-(dimethylhydrazinylidene)-5,5,5-trifluoro-1-thiophen-2-ylpent-3-en-2-one |
|---|---|
| PubChem CID | 25269989 |
| Molecular Formula | C19H15F3N2OS2 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | (Z,1Z)-4-(1-benzothiophen-2-yl)-1-(dimethylhydrazinylidene)-5,5,5-trifluoro-1-thiophen-2-ylpent-3-en-2-one |
| SMILES | CN(C)/N=C(/C(=O)/C=C(\c1cc2ccccc2s1)C(F)(F)F)c1cccs1 |
| InChI | InChI=1S/C19H15F3N2OS2/c1-24(2)23-18(16-8-5-9-26-16)14(25)11-13(19(20,21)22)17-10-12-6-3-4-7-15(12)27-17/h3-11H,1-2H3/b13-11+,23-18- |
| InChIKey | NIIRFIJHOQAJAV-GLZSIORYSA-N |
| XLogP | 5.44 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|