About 3-chloro-2,5-diphenylthiophene
3-chloro-2,5-diphenylthiophene (PubChem CID 25270072) has the molecular formula C16H11ClS
and a molecular weight of 270.78 g/mol. Its IUPAC name is 3-chloro-2,5-diphenylthiophene.
Molecular Properties
| Compound Name | 3-chloro-2,5-diphenylthiophene |
| PubChem CID | 25270072 |
| Molecular Formula | C16H11ClS |
| Molecular Weight | 270.78 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 3-chloro-2,5-diphenylthiophene |
| SMILES | Clc1cc(-c2ccccc2)sc1-c1ccccc1 |
| InChI | InChI=1S/C16H11ClS/c17-14-11-15(12-7-3-1-4-8-12)18-16(14)13-9-5-2-6-10-13/h1-11H |
| InChIKey | CKTFOIYDRRACGK-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.78 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-chloro-2,5-diphenylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2,5-diphenylthiophene?
The IUPAC name of 3-chloro-2,5-diphenylthiophene (CID 25270072) is 3-chloro-2,5-diphenylthiophene.
What is the SMILES notation for 3-chloro-2,5-diphenylthiophene?
The canonical SMILES for 3-chloro-2,5-diphenylthiophene is Clc1cc(-c2ccccc2)sc1-c1ccccc1.
What is the InChIKey of 3-chloro-2,5-diphenylthiophene?
The InChIKey is CKTFOIYDRRACGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11ClS/c17-14-11-15(12-7-3-1-4-8-12)18-16(14)13-9-5-2-6-10-13/h1-11H.
What are the key properties of 3-chloro-2,5-diphenylthiophene?
3-chloro-2,5-diphenylthiophene has a molecular weight of 270.78 g/mol, XLogP of 5.74, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2,5-diphenylthiophene is sourced from PubChem (CID 25270072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).