C20H18Cl2N2O2 — CID 25270194
8-[[5-(3,4-dichlorophenyl)-4-methyl-1,3-oxazol-2-yl]amino]-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 25270194) has the molecular formula C20H18Cl2N2O2 and a molecular weight of 389.28 g/mol. Its IUPAC name is 8-[[5-(3,4-dichlorophenyl)-4-methyl-1,3-oxazol-2-yl]amino]-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | 8-[[5-(3,4-dichlorophenyl)-4-methyl-1,3-oxazol-2-yl]amino]-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 25270194 |
| Molecular Formula | C20H18Cl2N2O2 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 8-[[5-(3,4-dichlorophenyl)-4-methyl-1,3-oxazol-2-yl]amino]-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | Cc1nc(Nc2cccc3c2CC(O)CC3)oc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H18Cl2N2O2/c1-11-19(13-6-8-16(21)17(22)9-13)26-20(23-11)24-18-4-2-3-12-5-7-14(25)10-15(12)18/h2-4,6,8-9,14,25H,5,7,10H2,1H3,(H,23,24) |
| InChIKey | ILTSFMMDLNDSDA-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |