C17H22N2O5 — CID 25270620
(3R,9aS)-8-(2,2-dimethoxyethyl)-3-phenyl-3,6,7,9a-tetrahydro-1H-[1,3]oxazolo[3,4-a][1,4]diazepine-5,9-dione (PubChem CID 25270620) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is (3R,9aS)-8-(2,2-dimethoxyethyl)-3-phenyl-3,6,7,9a-tetrahydro-1H-[1,3]oxazolo[3,4-a][1,4]diazepine-5,9-dione.
| Compound Name | (3R,9aS)-8-(2,2-dimethoxyethyl)-3-phenyl-3,6,7,9a-tetrahydro-1H-[1,3]oxazolo[3,4-a][1,4]diazepine-5,9-dione |
|---|---|
| PubChem CID | 25270620 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (3R,9aS)-8-(2,2-dimethoxyethyl)-3-phenyl-3,6,7,9a-tetrahydro-1H-[1,3]oxazolo[3,4-a][1,4]diazepine-5,9-dione |
| SMILES | COC(CN1CCC(=O)N2[C@@H](c3ccccc3)OC[C@H]2C1=O)OC |
| InChI | InChI=1S/C17H22N2O5/c1-22-15(23-2)10-18-9-8-14(20)19-13(16(18)21)11-24-17(19)12-6-4-3-5-7-12/h3-7,13,15,17H,8-11H2,1-2H3/t13-,17+/m0/s1 |
| InChIKey | TVZXYFAZIQCJMN-SUMWQHHRSA-N |
| XLogP | 0.76 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|