C13H16O3S — CID 25270676
(1R,2S,4R,5S,6S)-2-methyl-4-(4-methylphenyl)sulfanyl-3,7-dioxabicyclo[4.1.0]heptan-5-ol (PubChem CID 25270676) has the molecular formula C13H16O3S and a molecular weight of 252.33 g/mol. Its IUPAC name is (1R,2S,4R,5S,6S)-2-methyl-4-(4-methylphenyl)sulfanyl-3,7-dioxabicyclo[4.1.0]heptan-5-ol.
| Compound Name | (1R,2S,4R,5S,6S)-2-methyl-4-(4-methylphenyl)sulfanyl-3,7-dioxabicyclo[4.1.0]heptan-5-ol |
|---|---|
| PubChem CID | 25270676 |
| Molecular Formula | C13H16O3S |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | (1R,2S,4R,5S,6S)-2-methyl-4-(4-methylphenyl)sulfanyl-3,7-dioxabicyclo[4.1.0]heptan-5-ol |
| SMILES | Cc1ccc(S[C@H]2O[C@@H](C)[C@H]3O[C@H]3[C@@H]2O)cc1 |
| InChI | InChI=1S/C13H16O3S/c1-7-3-5-9(6-4-7)17-13-10(14)12-11(16-12)8(2)15-13/h3-6,8,10-14H,1-2H3/t8-,10-,11+,12-,13+/m0/s1 |
| InChIKey | SEUFQTXIEVKCSH-AHRFKUBPSA-N |
| XLogP | 1.96 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|