C31H28FN5O4S — CID 25270925
1-(3-acetylphenyl)-3-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]urea (PubChem CID 25270925) has the molecular formula C31H28FN5O4S and a molecular weight of 585.66 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-3-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]urea.
| Compound Name | 1-(3-acetylphenyl)-3-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]urea |
|---|---|
| PubChem CID | 25270925 |
| Molecular Formula | C31H28FN5O4S |
| Molecular Weight | 585.66 g/mol |
| Exact Mass | 585.18 |
| IUPAC Name | 1-(3-acetylphenyl)-3-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]urea |
| SMILES | COCCNCc1ccc(-c2cc3nccc(Oc4ccc(NC(=O)Nc5cccc(C(C)=O)c5)cc4F)c3s2)nc1 |
| InChI | InChI=1S/C31H28FN5O4S/c1-19(38)21-4-3-5-22(14-21)36-31(39)37-23-7-9-27(24(32)15-23)41-28-10-11-34-26-16-29(42-30(26)28)25-8-6-20(18-35-25)17-33-12-13-40-2/h3-11,14-16,18,33H,12-13,17H2,1-2H3,(H2,36,37,39) |
| InChIKey | TYMWLYKUEKTMLY-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.66 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|