C11H13N5O2 — CID 25271557
6-(2-phenoxyethoxy)-1,3,5-triazine-2,4-diamine (PubChem CID 25271557) has the molecular formula C11H13N5O2 and a molecular weight of 247.26 g/mol. Its IUPAC name is 6-(2-phenoxyethoxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2-phenoxyethoxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 25271557 |
| Molecular Formula | C11H13N5O2 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 6-(2-phenoxyethoxy)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(OCCOc2ccccc2)n1 |
| InChI | InChI=1S/C11H13N5O2/c12-9-14-10(13)16-11(15-9)18-7-6-17-8-4-2-1-3-5-8/h1-5H,6-7H2,(H4,12,13,14,15,16) |
| InChIKey | LRQXUZUFSOQMGU-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 109.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|