C17H26N2O3S — CID 25271984
4-methyl-N-[(2S)-4-methyl-1-oxo-1-pyrrolidin-1-ylpentan-2-yl]benzenesulfonamide (PubChem CID 25271984) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is 4-methyl-N-[(2S)-4-methyl-1-oxo-1-pyrrolidin-1-ylpentan-2-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(2S)-4-methyl-1-oxo-1-pyrrolidin-1-ylpentan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 25271984 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 4-methyl-N-[(2S)-4-methyl-1-oxo-1-pyrrolidin-1-ylpentan-2-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](CC(C)C)C(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C17H26N2O3S/c1-13(2)12-16(17(20)19-10-4-5-11-19)18-23(21,22)15-8-6-14(3)7-9-15/h6-9,13,16,18H,4-5,10-12H2,1-3H3/t16-/m0/s1 |
| InChIKey | UDKIRDCGKZABIL-INIZCTEOSA-N |
| XLogP | 2.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |