C18H23N3O — CID 25275368
[(3S)-3-anilinopiperidin-1-yl]-(3,5-dimethyl-1H-pyrrol-2-yl)methanone (PubChem CID 25275368) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is [(3S)-3-anilinopiperidin-1-yl]-(3,5-dimethyl-1H-pyrrol-2-yl)methanone.
| Compound Name | [(3S)-3-anilinopiperidin-1-yl]-(3,5-dimethyl-1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 25275368 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | [(3S)-3-anilinopiperidin-1-yl]-(3,5-dimethyl-1H-pyrrol-2-yl)methanone |
| SMILES | Cc1cc(C)c(C(=O)N2CCC[C@H](Nc3ccccc3)C2)[nH]1 |
| InChI | InChI=1S/C18H23N3O/c1-13-11-14(2)19-17(13)18(22)21-10-6-9-16(12-21)20-15-7-4-3-5-8-15/h3-5,7-8,11,16,19-20H,6,9-10,12H2,1-2H3/t16-/m0/s1 |
| InChIKey | HIISGUCGNGXBFB-INIZCTEOSA-N |
| XLogP | 3.35 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |