C19H27N3O3 — CID 25280159
3-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)piperidin-1-yl]methyl]-1,2,4-oxadiazole (PubChem CID 25280159) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)piperidin-1-yl]methyl]-1,2,4-oxadiazole.
| Compound Name | 3-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)piperidin-1-yl]methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 25280159 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 3-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)piperidin-1-yl]methyl]-1,2,4-oxadiazole |
| SMILES | COCCCC1CCN(Cc2nc(-c3ccc(OC)cc3)no2)CC1 |
| InChI | InChI=1S/C19H27N3O3/c1-23-13-3-4-15-9-11-22(12-10-15)14-18-20-19(21-25-18)16-5-7-17(24-2)8-6-16/h5-8,15H,3-4,9-14H2,1-2H3 |
| InChIKey | YNMVQLTWBAMRNV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 60.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|