C22H17NO4 — CID 25282401
9-(furan-2-ylmethyl)-3-phenyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one (PubChem CID 25282401) has the molecular formula C22H17NO4 and a molecular weight of 359.38 g/mol. Its IUPAC name is 9-(furan-2-ylmethyl)-3-phenyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one.
| Compound Name | 9-(furan-2-ylmethyl)-3-phenyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
|---|---|
| PubChem CID | 25282401 |
| Molecular Formula | C22H17NO4 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 9-(furan-2-ylmethyl)-3-phenyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
| SMILES | O=c1oc2c3c(ccc2cc1-c1ccccc1)OCN(Cc1ccco1)C3 |
| InChI | InChI=1S/C22H17NO4/c24-22-18(15-5-2-1-3-6-15)11-16-8-9-20-19(21(16)27-22)13-23(14-26-20)12-17-7-4-10-25-17/h1-11H,12-14H2 |
| InChIKey | SRVDLFFQFDONJY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 55.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|